Online Database of Chemicals from Around the World
| Product Name | CAS Registry Number | Molecular Formula |
|---|---|---|
| 29H,31H-Phthalocyanine, Lithium Salt (1:1) | 111716-29-1 | C32H18LiN8 |
| Phthalocyanine Silver | 12376-32-8 | C32H16Ag2N8 |
| 29H,31H-Phthalocyanine-1,2,3,4-Tetrasulfonate, Copper(2+) Sodium Salt (1:1:4) | 27360-85-6 | C32H14CuN8Na4O12S4 |
| [29H,31H-Phthalocyanine-C,C,C,C-tetrasulfonato(6-)-N29,N30,N31,N32]cuprate(4-) tetrahydrogen compd. with N,N',N''-triphenylguanidine (1:4) | 63526-72-7 | C32H12CuN8O12S4.4(C19H17N3).4H |
| 29H,29H,31H-Phthalocyanine-C,C,C,C-Tetrasulfonic Acid | 33308-41-7 | |
| 29H,30H-Phthalocyanine-1,2,3,4-Tetrasulfonic Acid, Aluminum Salt (1:1) | 122170-90-5 | C32H18AlN8O12S4 |
| 29H,31H-Phthalocyanine-1,2,3,4-Tetrasulfonic Acid, Cerium(3+) Salt (1:1) | 105155-92-8 | C32H18CeN8O12S4 |
| 29H,31H-Phthalocyanine-1,2,3,4-Tetrasulfonic Acid, Cobalt(2+) Salt (1:1) | 28802-06-4 | C32H18CoN8O12S4 |
| 29H,31H-Phthalocyanine-1,2,3,4-Tetrasulfonic Acid, Gallium Salt (1:1) | 105155-90-6 | C32H18GaN8O12S4 |
| 29H,31H-Phthalocyanine-1,2,3,4-Tetrasulfonic Acid, Iron(2+) Salt (1:1) | 1277-38-9 | C32H18FeN8O12S4 |
| 29H,31H-Phthalocyanine-1,2,3,4-Tetrasulfonic Acid, Zinc Salt (1:1) | 61586-86-5 | C32H18N8O12S4Zn |
| 29H,31H-Phthalocyanine-1,2,3,4-Tetrol, Zinc Salt (1:1) | 113383-08-7 | C32H18N8O4Zn |
| [29H,31H-Phthalocyanine-C,C,C-Trisulfonamidato]-Copper | 74708-59-1 | |
| 29H,31H-Phthalocyanine-1,2,3-Trisulfonic Acid, Gallium Salt (1:1) | 108914-60-9 | C32H18GaN8O9S3 |
| (N-(29H,31H-Phthalocyaninylmethyl)Piperidine-1-Acetamidato)Copper | 72506-31-1 | |
| Phthalonic Acid | 528-46-1 | C9H6O5 |
| Phthalonitrile | 91-15-6 | C8H4N2 |
| Phthaloyl amlodipine | 88150-62-3 | C28H27ClN2O7 |
| 2,2'-Phthaloyl Bis(Trimethylhydrazinium) | 103739-44-2 | C14H22N4O2 |
| Phthaloyl dichloride | 88-95-9 | C8H4Cl2O2 |
| Phthaloyl Difluoride | 445-69-2 | C8H4F2O2 |
| N-Phthaloyl-L-glutamic acid | 340-90-9 | C13H11NO6 |
| N-Phthaloyl-DL-Glutamic Anhydride | 3085-92-5 | C13H9NO5 |
| N-Phthaloyl-DL-Glutamic Anhydride | 3343-28-0 | C13H9NO5 |
| 3-N-Phthaloylglyaminomethyl Aniline | 77147-14-9 | C15H12N2O2 |
| N-Phthaloylglycine | 4702-13-0 | C10H7NO4 |
| Phthaloyl-glycine hydroxysuccinimide ester | 3397-29-3 | C14H10N2O6 |
| Phthaloylglycylglycine | 3916-40-3 | C12H10N2O5 |
| N-alpha-Phthaloyl-DL-isoglutamine methyl ester | 19143-28-3 | C14H14N2O5 |
| N-Phthaloyl-L-isoleucine | 29588-88-3 | C14H15NO4 |
| N-Phthaloyl-DL-Methionine | 52881-96-6 | C13H12NO4S |
| Phthaloyl Peroxide | 4733-52-2 | C8H4O4 |
| N-Phthaloyl-L-phenylalanine | 5123-55-7 | C17H13NO4 |
| N-Phthaloyl-L-tryptophan | 48208-26-0 | C19H14N2O4 |
| Phthalyl-DL-Glutamic Acid | 6349-98-0 (2301-52-2) | C13H11NO6 |
| N-alpha-Phthalyl-L-Glutamine | 3343-29-1 | C13H12N2O5 |
| Phthalylglycyl chloride | 6780-38-7 | C10H6ClNO3 |
| Phthalylsulfamethizol | 485-24-5 | C17H14N4O5S2 |
| Phthalylsulfathiazole | 85-73-4 | C17H13N3O5S2 |
| Phthiobuzone | 79512-50-8 | C14H15N7O2S2 |
| Phthoramycin | 119313-46-1 | C40H68O12 |
| PHV 42 | 111366-38-2 | C202H325N53O64S |
| Phycobilin | 20298-86-6 | C33H38N4O6 |
| C-Phycocyanin | 11016-15-2 | |
| rac-Phycocyanobilin | 215871-76-4 | C33H38N4O6 |
| Phycoerythrins, R-Phycoerythrins | 11016-17-4 | |
| Phycoerythrobilin | 18097-67-1 | C33H38N4O6 |
| Phyllanthoside | 63166-73-4 | C40H52O17 |
| Phyllanthostatin 6 | 132282-94-1 | C36H48O16 |
| Phyllanthostatin A | 119767-19-0 | C29H30O13 |