Online Database of Chemicals from Around the World
| Product Name | CAS Registry Number | Molecular Formula |
|---|---|---|
| Dodecanedioic Acid Di(2-Ethylhexyl) Ester | 19074-24-9 | C28H54O4 |
| Dodecanedioic Acid 1-Methyl Ester Barium Salt | 122107-56-6 | C26H48BaO8 |
| Dodecanedioic acid monoethyl ester | 66003-63-2 | C14H26O4 |
| Dodecanedioic Acid Monomethyl Ester | 3903-40-0 | C13H24O4 |
| Dodecanedioic Acid, Polymer With 6-Aminohexanoic Acid, Decanedioic Acid, 1,6-Hexanediamine And Hexanedioic Acid | 71215-68-4 | C40H79N3O14 |
| Dodecanedioic Acid, Polymer With Decanedioic Acid, Hexahydro-2H-Azepin-2-One And 1,6-Hexanediamine | 52257-07-5 | C34H67N3O9 |
| Dodecanedioic acid, polymer with 1,12-dodecanediamine | 36497-34-4 | C24H50N2O4 |
| Dodecanedioic Acid, Polymer With Hexahydro-2H-Azepin-2-One And 1,6-Hexanediamine | 51733-10-9 | C24H49N3O5 |
| Dodecanedioic acid sodium salt, compd. with 2,2',2''-nitrilotris[ethanol] | 85049-97-4 | C12H22O4.x(C6H15NO3).x(Na) |
| 1,2-Dodecanediol | 1119-87-5 | C12H26O2 |
| 1,12-Dodecanediol | 5675-51-4 | C12H26O2 |
| (5S,6R)-5,6-Dodecanediol | 70859-32-4 | C12H26O2 |
| (5R,6R)-5,6-Dodecanediol | 70859-33-5 | C12H26O2 |
| (R)-1,2-Dodecanediol | 85514-84-7 | |
| (S)-1,2-Dodecanediol | 85514-85-8 | C12H26O2 |
| 1,12-Dodecanediol dimethacrylate | 72829-09-5 | C20H34O4 |
| 2,11-Dodecanedione | 7029-09-6 | C12H22O2 |
| Dodecanedioyl dichloride | 4834-98-4 | C12H20Cl2O2 |
| 1,12-Dodecanedioyl dihydrazide | 4080-98-2 | C12H26N4O2 |
| 1,1'-(Dodecane-1,12-Diyl)Bis[2-Amino-1,5-Dihydro-4H-Imidazol-4-One] | 94109-90-7 | C18H32N6O2 |
| 1,1'-(Dodecane-1,12-Diyl)Bisimidazolidine-2,4-Dione | 94134-11-9 | C18H30N4O4 |
| 1,1'-(Dodecane-1,12-Diyl)Bis-1H-Pyrrole-2,5-Dione | 27574-80-7 | C20H28N2O4 |
| 2,2'-[Dodecane-1,12-Diylbis(Thio)]Bisethanol | 41891-96-7 | C16H34O2S2 |
| N,N'''-Dodecane-1,12-Diylbis[1,3,5-Triazine-2,4,6-Triamine] | 61912-28-5 | C18H34N12 |
| 1,12-Dodecanediylbis(tributylphosphonium) dibromide | 99372-74-4 | C36H78Br2P2 |
| 1,1'(Dodecane-1,12-Diyl)Dibenzene | 5368-74-1 | C24H34 |
| 4,4'-(1,1-Dodecanediyl)diphenol | 74462-04-7 | C24H34O2 |
| Dodecanenitrile | 2437-25-4 | C12H23N |
| Dodecaneperoxoic acid | 2388-12-7 | C12H24O3 |
| Dodecaneperoxoic Acid 1,1-Dimethylethyl Ester | 2123-88-8 | C16H32O3 |
| Dodecane-1-Sulfonic Acid | 38480-64-7 | C12H26O3S |
| 1-Dodecanesulfonic acid sodium salt | 17341-25-2 | Na |
| 1-Dodecanesulfonylchloride | 10147-40-7 | C12H25ClO2S |
| Dodecane-1-Sulphonic Acid | 1510-16-3 | C12H25NaO3S |
| Dodecane-1,1,12,12-Tetracarboxylic Acid | 68025-28-5 | C16H26O8 |
| Dodecanethioic Acid Anhydrosulfide | 19659-64-4 | C24H46O2S |
| 1-Dodecanethiol | 112-55-0 | C12H26S |
| Dodecanethiol | 1322-36-7 | C12H26S |
| 2-Dodecanethiol | 14402-50-7 | C12H26S |
| 1-Dodecanethiol, silver(1+) salt (1:1) | 93917-83-0 | C12H26AgS |
| 2-Dodecanethiol, telomer with 1,3-butadiene and 2-propenenitrile | 68140-82-9 | |
| (1E)-Dodecanimidamide | 100392-19-6 | C12H26N2 |
| dodecanoate, (E)-1-[(E)-prop-1-enoxy]prop-1-ene | 94108-27-7 | C30H56O5 |
| Dodecanoate, lambda2-Stannane | 14974-55-1 | C24H48O4Sn |
| Dodecanohydrazide | 5399-22-4 | C12H26N2O |
| Dodecanoic-2-13C Acid | 287100-78-1 | |
| Dodecanoic Acid-12-13C | 287100-85-0 | |
| Dodecanoic-D23 Acid | 59154-43-7 | |
| (2,2-2H2)Dodecanoic acid | 64118-39-4 | C12H22D2O2 |
| Dodecanoic-1-13C Acid | 93639-08-8 |